Products 16732-71-1
CAS 16732-71-1 appears in our catalog under these names: 7–Bromoindole–2–carboxylic acid, 7-Bromo-1H-indole-2-carboxylic acid, 7-Bromo-1H-indole-2-carboxylic acid, 95%, 95%, 7-Bromo-1H-indole-2-carboxylic acid, 95%, 7-Bromoindole-2-carboxylic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 500mg, 1000mg, 2500mg, 5000mg, 100mg.
7-bromo-1H-indole-2-carboxylic acid (CAS 16732-71-1) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 7-bromo-1H-indole-2-carboxylic acid. InChIKey: ZKGMXVLKFBRKNN-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 7-bromo-1H-indole-2-carboxylic acid |
| InChIKey | ZKGMXVLKFBRKNN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=C2)C(=O)O |
Computed by PubChem (NCBI)