CAS 16732-73-3 appears in our catalog under these names: 6-Methoxyindole-2-carboxylic Acid, 6–Methoxyindole–2–carboxylic acid, 6-Methoxyindole-2-carboxylic acid 98%, 1H-Indole-2-carboxylic acid, 6-methoxy-, 98%, 98%, 6-Methoxy-1 H -indole-2-carboxylic acid, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 2,5g, 25g, 1g, 5g, 250mg.
6-methoxy-1H-indole-2-carboxylic acid (CAS 16732-73-3) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 6-methoxy-1H-indole-2-carboxylic acid. InChIKey: XNBGANWAZJWOHS-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 6-methoxy-1H-indole-2-carboxylic acid |
| InChIKey | XNBGANWAZJWOHS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)