CAS 167626-64-4 appears in our catalog under these names: 3-(1H-1,2,4-Triazol-1-yl)benzoic acid, 97%, 3-(1,2,4-Triazol-1-yl)benzoic Acid, 97%, 3–(1H–1,2,4–Triazol–1–yl)benzoic Acid, 3-(1H-1,2,4-Triazol-1-yl)benzoic acid, 97% , 3-(1H-1,2,4-Triazol-1-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific, Biosynth. Available pack sizes: 25g, 1g, 5g, 10g, 250MG.
3-(1,2,4-triazol-1-yl)benzoic acid (CAS 167626-64-4) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 3-(1,2,4-triazol-1-yl)benzoic acid. InChIKey: SZKWCOCFEIVCAB-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-(1,2,4-triazol-1-yl)benzoic acid |
| InChIKey | SZKWCOCFEIVCAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=NC=N2)C(=O)O |
Computed by PubChem (NCBI)