CAS 168123-82-8 appears in our catalog under these names: 7–Bromopyrido(2,3–b)pyrazine–2,3(1H,4H)–dione, 7-Bromopyrido[2,3-b]pyrazine-2,3(1H,4H)-dione, 97%, 97%, 7-Bromo-2,3-dioxo-1,4-dihydro-pyrido[2,3-b]pyrazine, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
7-bromo-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione (CAS 168123-82-8) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 7-bromo-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione. InChIKey: SMQUNTGAPNGDHP-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 7-bromo-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
| InChIKey | SMQUNTGAPNGDHP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1NC(=O)C(=O)N2)Br |
Computed by PubChem (NCBI)