Products 16825-27-7
CAS 16825-27-7 is the registry number for (2S)-3-(3,4-Dimethoxyphenyl)-2-acetamido-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S)-2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid (CAS 16825-27-7) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: (2S)-2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid. InChIKey: VIQGMKBBYLJABC-AWEZNQCLSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid |
| InChIKey | VIQGMKBBYLJABC-AWEZNQCLSA-N |
| SMILES | CC(=O)N[C@@](C)(CC1=CC(=C(C=C1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)