Products 2503-39-1
CAS 2503-39-1 appears in our catalog under these names: N-Acetyl D-Alpha-Methyl DOPA Dimethyl Ether, N-Acetyl D-a-Methyl DOPA Dimethyl Ether, (2R)-3-(3,4-Dimethoxyphenyl)-2-acetamido-2-methylpropanoic acid, 95%, (2R)-3-(3,4-Dimethoxyphenyl)-2-acetamido-2-methylpropanoic acid. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 10mg, 25mg, 5mg, 1g, 50mg, 0,5g.
(2R)-2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid (CAS 2503-39-1) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: (2R)-2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid. InChIKey: VIQGMKBBYLJABC-CQSZACIVSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid |
| InChIKey | VIQGMKBBYLJABC-CQSZACIVSA-N |
| SMILES | CC(=O)N[C@](C)(CC1=CC(=C(C=C1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)