CAS 5934-66-7 is the registry number for N-Acetyl D,L-Alpha-Methyl DOPA Dimethyl Ether. Offered by: TRC. Available pack sizes: 250mg, 25mg.
2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid (CAS 5934-66-7) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: 2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid. InChIKey: VIQGMKBBYLJABC-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 2-acetamido-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid |
| InChIKey | VIQGMKBBYLJABC-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C)(CC1=CC(=C(C=C1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)