Products 168271-91-8
CAS 168271-91-8 is the registry number for 4-Oxo-4,5,6,7-tetrahydro-1H-indole-3-carboxylic acid, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-oxo-1,5,6,7-tetrahydroindole-3-carboxylic acid (CAS 168271-91-8) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 4-oxo-1,5,6,7-tetrahydroindole-3-carboxylic acid. InChIKey: IOPXFUALWUTZQK-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 4-oxo-1,5,6,7-tetrahydroindole-3-carboxylic acid |
| InChIKey | IOPXFUALWUTZQK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)