Products 16849-78-8
CAS 16849-78-8 appears in our catalog under these names: Methyl 2-formyl-3,5-dihydroxybenzoate, 97%, Methyl 2-formyl-3,5-dihydroxybenzoate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 1g, 5g.
Methyl 2-formyl-3,5-dihydroxybenzoate (CAS 16849-78-8) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: methyl 2-formyl-3,5-dihydroxybenzoate. InChIKey: LOKLRMRSNQLRFN-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | methyl 2-formyl-3,5-dihydroxybenzoate |
| InChIKey | LOKLRMRSNQLRFN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)O)O)C=O |
Computed by PubChem (NCBI)