CAS 16851-01-7 appears in our catalog under these names: 7–(3'–Carboxybutoxy)coumarin, 7-(3'-Carboxybutoxy)coumarin. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
2-methyl-4-(2-oxochromen-7-yl)oxybutanoic acid (CAS 16851-01-7) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: 2-methyl-4-(2-oxochromen-7-yl)oxybutanoic acid. InChIKey: UFNOBOOKHSJUHM-UHFFFAOYSA-N.
| Molecular formula | C14H14O5 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 2-methyl-4-(2-oxochromen-7-yl)oxybutanoic acid |
| InChIKey | UFNOBOOKHSJUHM-UHFFFAOYSA-N |
| SMILES | CC(CCOC1=CC2=C(C=C1)C=CC(=O)O2)C(=O)O |
Computed by PubChem (NCBI)