CAS 168893-31-0 appears in our catalog under these names: 5-(3-Chlorophenyl)-4H-1,2,4-triazol-3-amine, 95%, 5-(3-Chlorophenyl)-4H-1,2,4-triazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-(3-chlorophenyl)-1H-1,2,4-triazol-3-amine (CAS 168893-31-0) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 5-(3-chlorophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: HDGWVCJSAKDJRW-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | HDGWVCJSAKDJRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=NN2)N |
Computed by PubChem (NCBI)