CAS 169040-78-2 is the registry number for 5-Ethoxyindoline-2,3-dione, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
5-ethoxy-1H-indole-2,3-dione (CAS 169040-78-2) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 5-ethoxy-1H-indole-2,3-dione. InChIKey: VPBTXKVUDRKXBP-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 5-ethoxy-1H-indole-2,3-dione |
| InChIKey | VPBTXKVUDRKXBP-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)NC(=O)C2=O |
Computed by PubChem (NCBI)