Products 1693738-73-6
CAS 1693738-73-6 is the registry number for 5-(2,3-Dihydro-1H-inden-2-yl)-1H-pyrazol-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,3-dihydro-1H-inden-2-yl)-1H-pyrazol-3-amine (CAS 1693738-73-6) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 5-(2,3-dihydro-1H-inden-2-yl)-1H-pyrazol-3-amine. InChIKey: BRLUDFFBDSJZRK-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 5-(2,3-dihydro-1H-inden-2-yl)-1H-pyrazol-3-amine |
| InChIKey | BRLUDFFBDSJZRK-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC=CC=C21)C3=CC(=NN3)N |
Computed by PubChem (NCBI)