Products 1698027-86-9
CAS 1698027-86-9 appears in our catalog under these names: 2-Amino-4-bromo-3,5-difluorobenzoic acid, 98%, 98%, 2-Amino-4-bromo-3,5-difluorobenzoic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-amino-4-bromo-3,5-difluorobenzoic acid (CAS 1698027-86-9) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 2-amino-4-bromo-3,5-difluorobenzoic acid. InChIKey: HMEMIUSIGMVLLA-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 2-amino-4-bromo-3,5-difluorobenzoic acid |
| InChIKey | HMEMIUSIGMVLLA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)F)N)C(=O)O |
Computed by PubChem (NCBI)