CAS 1698535-33-9 appears in our catalog under these names: 2–Amino–4–bromo–3,6–difluorobenzoic acid, 2-Amino-4-bromo-3,6-difluorobenzoic acid, 98%, 98%, 2-Amino-4-bromo-3,6-difluorobenzoic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g.
2-amino-4-bromo-3,6-difluorobenzoic acid (CAS 1698535-33-9) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 2-amino-4-bromo-3,6-difluorobenzoic acid. InChIKey: VMZKZXMOHWFESX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 2-amino-4-bromo-3,6-difluorobenzoic acid |
| InChIKey | VMZKZXMOHWFESX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)N)C(=O)O)F |
Computed by PubChem (NCBI)