CAS 1698682-03-9 is the registry number for 2,3-Difluoro-4-methylbenzenesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2,3-difluoro-4-methylbenzenesulfonyl chloride (CAS 1698682-03-9) is a chemical compound with the molecular formula C7H5ClF2O2S and a molecular weight of 226.63 g/mol. IUPAC name: 2,3-difluoro-4-methylbenzenesulfonyl chloride. InChIKey: NYOZHVMXONVVSX-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O2S |
|---|---|
| Molecular weight | 226.63 g/mol |
| IUPAC name | 2,3-difluoro-4-methylbenzenesulfonyl chloride |
| InChIKey | NYOZHVMXONVVSX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)S(=O)(=O)Cl)F)F |
Computed by PubChem (NCBI)