Products 1699482-82-0

CAS 1699482-82-0 is the registry number for 2-methoxy-5-nitroisonicotinic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2-methoxy-5-nitropyridine-4-carboxylic acid (CAS 1699482-82-0) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: 2-methoxy-5-nitropyridine-4-carboxylic acid. InChIKey: ZATBVTVOGBXWKO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O5
Molecular weight198.13 g/mol
IUPAC name2-methoxy-5-nitropyridine-4-carboxylic acid
InChIKeyZATBVTVOGBXWKO-UHFFFAOYSA-N
SMILESCOC1=NC=C(C(=C1)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)