CAS 170108-07-3 appears in our catalog under these names: Methyl 2-amino-3,4-difluorobenzoate, 97%, Methyl 2–amino–3,4–difluorobenzoate, Methyl 2-amino-3,4-difluorobenzoate, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 10g.
Methyl 2-amino-3,4-difluorobenzoate (CAS 170108-07-3) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 2-amino-3,4-difluorobenzoate. InChIKey: MQSMXRFDHQTFDU-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 2-amino-3,4-difluorobenzoate |
| InChIKey | MQSMXRFDHQTFDU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)F)N |
Computed by PubChem (NCBI)