Products 1702581-38-1

CAS 1702581-38-1 is the registry number for 3-chloro-2-(methylthio)isonicotinic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-chloro-2-methylsulfanylpyridine-4-carboxylic acid (CAS 1702581-38-1) is a chemical compound with the molecular formula C7H6ClNO2S and a molecular weight of 203.65 g/mol. IUPAC name: 3-chloro-2-methylsulfanylpyridine-4-carboxylic acid. InChIKey: QMSCVKDJGCIWKM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO2S
Molecular weight203.65 g/mol
IUPAC name3-chloro-2-methylsulfanylpyridine-4-carboxylic acid
InChIKeyQMSCVKDJGCIWKM-UHFFFAOYSA-N
SMILESCSC1=NC=CC(=C1Cl)C(=O)O

Computed by PubChem (NCBI)