CAS 1703927-61-0 is the registry number for (R)-Methyl 2-amino-2-(5-fluoro-2-hydroxyphenyl)acetate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl (2R)-2-amino-2-(5-fluoro-2-hydroxyphenyl)acetate;hydrochloride (CAS 1703927-61-0) is a chemical compound with the molecular formula C9H11ClFNO3 and a molecular weight of 235.64 g/mol. IUPAC name: methyl (2R)-2-amino-2-(5-fluoro-2-hydroxyphenyl)acetate;hydrochloride. InChIKey: KZTDCUJSCXIPMX-DDWIOCJRSA-N.
| Molecular formula | C9H11ClFNO3 |
|---|---|
| Molecular weight | 235.64 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(5-fluoro-2-hydroxyphenyl)acetate;hydrochloride |
| InChIKey | KZTDCUJSCXIPMX-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=C(C=CC(=C1)F)O)N.Cl |
Computed by PubChem (NCBI)