CAS 1821247-95-3 appears in our catalog under these names: Methyl 6-Amino-2-fluoro-3-methoxybenzoate Hydrochloride, >95%, >95%, Methyl 6-amino-2-fluoro-3-methoxybenzoate hydrochloride, 98%. Offered by: Chemat, Chemat Brand. Available pack sizes: 100mg, 250mg, 1g, on request.
Methyl 6-amino-2-fluoro-3-methoxybenzoate;hydrochloride (CAS 1821247-95-3) is a chemical compound with the molecular formula C9H11ClFNO3 and a molecular weight of 235.64 g/mol. IUPAC name: methyl 6-amino-2-fluoro-3-methoxybenzoate;hydrochloride. InChIKey: MFVZAPAQESHODA-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO3 |
|---|---|
| Molecular weight | 235.64 g/mol |
| IUPAC name | methyl 6-amino-2-fluoro-3-methoxybenzoate;hydrochloride |
| InChIKey | MFVZAPAQESHODA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)N)C(=O)OC)F.Cl |
Computed by PubChem (NCBI)