Products 2061980-54-7

CAS 2061980-54-7 is the registry number for 3-Amino-3-(3-fluoro-4-hydroxyphenyl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-amino-3-(3-fluoro-4-hydroxyphenyl)propanoic acid;hydrochloride (CAS 2061980-54-7) is a chemical compound with the molecular formula C9H11ClFNO3 and a molecular weight of 235.64 g/mol. IUPAC name: 3-amino-3-(3-fluoro-4-hydroxyphenyl)propanoic acid;hydrochloride. InChIKey: BRNZIGMSAOYUQY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClFNO3
Molecular weight235.64 g/mol
IUPAC name3-amino-3-(3-fluoro-4-hydroxyphenyl)propanoic acid;hydrochloride
InChIKeyBRNZIGMSAOYUQY-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(CC(=O)O)N)F)O.Cl

Computed by PubChem (NCBI)