Products 1803566-64-4

CAS 1803566-64-4 is the registry number for 2-Amino-2-(5-fluoro-2-methoxyphenyl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-amino-2-(5-fluoro-2-methoxyphenyl)acetic acid;hydrochloride (CAS 1803566-64-4) is a chemical compound with the molecular formula C9H11ClFNO3 and a molecular weight of 235.64 g/mol. IUPAC name: 2-amino-2-(5-fluoro-2-methoxyphenyl)acetic acid;hydrochloride. InChIKey: KIPXTFXELOFVEU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClFNO3
Molecular weight235.64 g/mol
IUPAC name2-amino-2-(5-fluoro-2-methoxyphenyl)acetic acid;hydrochloride
InChIKeyKIPXTFXELOFVEU-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)F)C(C(=O)O)N.Cl

Computed by PubChem (NCBI)