CAS 1810074-58-8 appears in our catalog under these names: (S)-2-Amino-2-(4-fluoro-3-methoxyphenyl)acetic acid hydrochloride, 95%, (S)–2–Amino–2–(4–fluoro–3–methoxyphenyl)acetic acid hydrochloride, (S)-2-Amino-2-(4-fluoro-3-methoxyphenyl)acetic acid hydrochloride, 95%, 95%, (2S)-2-AMINO-2-(4-FLUORO-3-METHOXYPHENYL)ACETIC ACID-HCL, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(2S)-2-amino-2-(4-fluoro-3-methoxyphenyl)acetic acid;hydrochloride (CAS 1810074-58-8) is a chemical compound with the molecular formula C9H11ClFNO3 and a molecular weight of 235.64 g/mol. IUPAC name: (2S)-2-amino-2-(4-fluoro-3-methoxyphenyl)acetic acid;hydrochloride. InChIKey: BMJIRSBYZJOWGS-QRPNPIFTSA-N.
| Molecular formula | C9H11ClFNO3 |
|---|---|
| Molecular weight | 235.64 g/mol |
| IUPAC name | (2S)-2-amino-2-(4-fluoro-3-methoxyphenyl)acetic acid;hydrochloride |
| InChIKey | BMJIRSBYZJOWGS-QRPNPIFTSA-N |
| SMILES | COC1=C(C=CC(=C1)[C@@H](C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)