Products 2097073-16-8
CAS 2097073-16-8 appears in our catalog under these names: 2-Fluoro-l-tyrosine hydrochloride, 95%, 2–Fluoro–L–tyrosine hydrochloride, 2-Fluoro-L-tyrosine hydrochloride, 95%, 95%, 2-Fluoro-L-tyrosine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
(2S)-2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoic acid;hydrochloride (CAS 2097073-16-8) is a chemical compound with the molecular formula C9H11ClFNO3 and a molecular weight of 235.64 g/mol. IUPAC name: (2S)-2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoic acid;hydrochloride. InChIKey: MVBVOABWDNQILK-QRPNPIFTSA-N.
| Molecular formula | C9H11ClFNO3 |
|---|---|
| Molecular weight | 235.64 g/mol |
| IUPAC name | (2S)-2-amino-3-(2-fluoro-4-hydroxyphenyl)propanoic acid;hydrochloride |
| InChIKey | MVBVOABWDNQILK-QRPNPIFTSA-N |
| SMILES | C1=CC(=C(C=C1O)F)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)