CAS 2060610-78-6 is the registry number for (R)–methyl 2–amino–2–(5–fluoro–2–hydroxyphenyl)acetate hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
Methyl (2R)-2-amino-2-(5-fluoro-2-hydroxyphenyl)acetate;hydrochloride (CAS 2060610-78-6) is a chemical compound with the molecular formula C9H11ClFNO3 and a molecular weight of 235.64 g/mol. IUPAC name: methyl (2R)-2-amino-2-(5-fluoro-2-hydroxyphenyl)acetate;hydrochloride. InChIKey: KZTDCUJSCXIPMX-DDWIOCJRSA-N.
| Molecular formula | C9H11ClFNO3 |
|---|---|
| Molecular weight | 235.64 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(5-fluoro-2-hydroxyphenyl)acetate;hydrochloride |
| InChIKey | KZTDCUJSCXIPMX-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=C(C=CC(=C1)F)O)N.Cl |
Computed by PubChem (NCBI)