Products 17040-20-9
CAS 17040-20-9 appears in our catalog under these names: 4-(Phenylamino)benzoic acid, 96%, 4–Anilinobenzoic acid, 4-(Phenylamino)benzoic acid, 4-(Phenylamino)benzoic acid 95%, 4-(Phenylamino)benzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
4-anilinobenzoic acid (CAS 17040-20-9) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 4-anilinobenzoic acid. InChIKey: DPAMLADQPZFXMD-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 4-anilinobenzoic acid |
| InChIKey | DPAMLADQPZFXMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)