Products 170572-47-1
CAS 170572-47-1 appears in our catalog under these names: Methyl 3,5-difluoro-4-hydroxybenzoate, 98%, Methyl 3，5–difluoro–4–hydroxybenzoate, 3,5-Difluoro-4-hydroxybenzoic acid methyl ester, Methyl 3,5-difluoro-4-hydroxybenzoate, 95%, 95%, 3,5-Difluoro-4-hydroxybenzoic acid methy, l ester, 500 mg. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 1000mg, 500mg, 2000mg.
Methyl 3,5-difluoro-4-hydroxybenzoate (CAS 170572-47-1) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: methyl 3,5-difluoro-4-hydroxybenzoate. InChIKey: GNFQIZAZPRYIFJ-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | methyl 3,5-difluoro-4-hydroxybenzoate |
| InChIKey | GNFQIZAZPRYIFJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)F)O)F |
Computed by PubChem (NCBI)