CAS 1706443-94-8 is the registry number for 3–(4–Chlorophenyl)–1,4–dioxane–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
3-(4-chlorophenyl)-1,4-dioxane-2-carboxylic acid (CAS 1706443-94-8) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,4-dioxane-2-carboxylic acid. InChIKey: SPHJGKXYYRNZOM-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,4-dioxane-2-carboxylic acid |
| InChIKey | SPHJGKXYYRNZOM-UHFFFAOYSA-N |
| SMILES | C1COC(C(O1)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)