Products 27821-11-0

CAS 27821-11-0 is the registry number for 1,2,3,4-Tetra-O-acetyl-a-L-rhamnopyranose. Offered by: Biosynth. Available pack sizes: 5g, 2g, 10g, 50g, 25g.

Structural formula: {0} (CAS {1})

[(2S,3S,4R,5R,6R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate (CAS 27821-11-0) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: [(2S,3S,4R,5R,6R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate. InChIKey: QZQMGQQOGJIDKJ-RBHVYLCKSA-N.

Identity
Molecular formulaC14H20O9
Molecular weight332.30 g/mol
IUPAC name[(2S,3S,4R,5R,6R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate
InChIKeyQZQMGQQOGJIDKJ-RBHVYLCKSA-N
SMILESC[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C

Computed by PubChem (NCBI)