CAS 27821-11-0 is the registry number for 1,2,3,4-Tetra-O-acetyl-a-L-rhamnopyranose. Offered by: Biosynth. Available pack sizes: 5g, 2g, 10g, 50g, 25g.
[(2S,3S,4R,5R,6R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate (CAS 27821-11-0) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: [(2S,3S,4R,5R,6R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate. InChIKey: QZQMGQQOGJIDKJ-RBHVYLCKSA-N.
| Molecular formula | C14H20O9 |
|---|---|
| Molecular weight | 332.30 g/mol |
| IUPAC name | [(2S,3S,4R,5R,6R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate |
| InChIKey | QZQMGQQOGJIDKJ-RBHVYLCKSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)