Products 1708371-53-2
CAS 1708371-53-2 is the registry number for 2-Chloro-2-(ethanesulfonyl)-1-phenylethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-2-ethylsulfonyl-1-phenylethanone (CAS 1708371-53-2) is a chemical compound with the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. IUPAC name: 2-chloro-2-ethylsulfonyl-1-phenylethanone. InChIKey: AIXKRDUDBZZHKM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | 2-chloro-2-ethylsulfonyl-1-phenylethanone |
| InChIKey | AIXKRDUDBZZHKM-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C(C(=O)C1=CC=CC=C1)Cl |
Computed by PubChem (NCBI)