Products 171179-93-4
CAS 171179-93-4 appears in our catalog under these names: 2-Amino-3H-pyrimido[4,5-b]indol-4(9H)-one, 97%, 97%, 2-Amino-3H-pyrimido[4,5-b]indol-4(9H)-one, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-amino-3,9-dihydropyrimido[4,5-b]indol-4-one (CAS 171179-93-4) is a chemical compound with the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. IUPAC name: 2-amino-3,9-dihydropyrimido[4,5-b]indol-4-one. InChIKey: QFPJRUKSXXTQNU-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O |
|---|---|
| Molecular weight | 200.20 g/mol |
| IUPAC name | 2-amino-3,9-dihydropyrimido[4,5-b]indol-4-one |
| InChIKey | QFPJRUKSXXTQNU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)N=C(NC3=O)N |
Computed by PubChem (NCBI)