Products 1713713-48-4
CAS 1713713-48-4 is the registry number for Ethyl 2-(difluoromethyl)-6-methylnicotinate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 2-(difluoromethyl)-6-methylpyridine-3-carboxylate (CAS 1713713-48-4) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: ethyl 2-(difluoromethyl)-6-methylpyridine-3-carboxylate. InChIKey: NENPKFYVTVFWMS-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | ethyl 2-(difluoromethyl)-6-methylpyridine-3-carboxylate |
| InChIKey | NENPKFYVTVFWMS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)C)C(F)F |
Computed by PubChem (NCBI)