CAS 1715-13-5 is the registry number for 4-((Thiophen-2-ylmethyl)amino)benzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-(thiophen-2-ylmethylamino)benzoic acid (CAS 1715-13-5) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: 4-(thiophen-2-ylmethylamino)benzoic acid. InChIKey: SHTQXYWTNXSOLW-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 4-(thiophen-2-ylmethylamino)benzoic acid |
| InChIKey | SHTQXYWTNXSOLW-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CNC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)