Products 171919-37-2
CAS 171919-37-2 appears in our catalog under these names: 1–Methyl–1H–pyrrolo(2，3–b)pyridine–3–carboxylic acid, 1-Methylpyrrolo(2,3-b)pyridine-3-carboxylic acid, 1-Methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid 95%, 1-Methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid, 95%, 95%, 1-METHYL-7-AZAINDOLE-3-CARBOXYLIC ACID, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS 171919-37-2) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid. InChIKey: KHIJNUGJNMUEFX-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid |
| InChIKey | KHIJNUGJNMUEFX-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1N=CC=C2)C(=O)O |
Computed by PubChem (NCBI)