CAS 172172-51-9 appears in our catalog under these names: 8-tert-butyl 2-methyl (1R,5S)-8-azabicyclo(3.2.1)oct-2-ene-2,8-dicarboxylate, 97%, 8-(tert-Butyl) 2-methyl (1R,5S)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate, 95%, O8-tert-butyl O2-methyl (1R,5S)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate, 97%. Offered by: AmBeed, BLDpharm, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg.
8-O-tert-butyl 2-O-methyl (1R,5S)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate (CAS 172172-51-9) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: 8-O-tert-butyl 2-O-methyl (1R,5S)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate. InChIKey: KEKHRISJFVUHMZ-MWLCHTKSSA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | 8-O-tert-butyl 2-O-methyl (1R,5S)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate |
| InChIKey | KEKHRISJFVUHMZ-MWLCHTKSSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1C(=CC2)C(=O)OC |
Computed by PubChem (NCBI)