Products 2382029-63-0
CAS 2382029-63-0 is the registry number for O8-tert-butyl O2-methyl (1S,5R)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
8-O-tert-butyl 2-O-methyl (1S,5R)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate (CAS 2382029-63-0) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: 8-O-tert-butyl 2-O-methyl (1S,5R)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate. InChIKey: KEKHRISJFVUHMZ-ONGXEEELSA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | 8-O-tert-butyl 2-O-methyl (1S,5R)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate |
| InChIKey | KEKHRISJFVUHMZ-ONGXEEELSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1C(=CC2)C(=O)OC |
Computed by PubChem (NCBI)