CAS 17306-95-5 is the registry number for 4-Aminophenyl β-D-xylopyranoside. Offered by: Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg.
(2S,3R,4S,5R)-2-(4-aminophenoxy)oxane-3,4,5-triol (CAS 17306-95-5) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. IUPAC name: (2S,3R,4S,5R)-2-(4-aminophenoxy)oxane-3,4,5-triol. InChIKey: QZFWYFWIDORFSN-YTWAJWBKSA-N.
| Molecular formula | C11H15NO5 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-(4-aminophenoxy)oxane-3,4,5-triol |
| InChIKey | QZFWYFWIDORFSN-YTWAJWBKSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)N)O)O)O |
Computed by PubChem (NCBI)