CAS 1732-46-3 appears in our catalog under these names: 5-Phenylisothiazole-3-carboxylic acid, 95+%, 5-Phenyl-1,2-thiazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg, 50mg, 0,5g.
5-phenyl-1,2-thiazole-3-carboxylic acid (CAS 1732-46-3) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 5-phenyl-1,2-thiazole-3-carboxylic acid. InChIKey: XHLZFLBTMYRLKD-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 5-phenyl-1,2-thiazole-3-carboxylic acid |
| InChIKey | XHLZFLBTMYRLKD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NS2)C(=O)O |
Computed by PubChem (NCBI)