CAS 17337-13-2 appears in our catalog under these names: 2-Biphenylisocyanate, 2-Biphenylylisocyanate 98%, 2-Biphenylisocyanate, 96%, 2-Biphenylylisocyanate, 98%, 98%, 2-Biphenyl Isocyanate, >98.0%(GC). Offered by: TRC, Ambeed, Fluorochem, Chemat, TCI. Available pack sizes: 100mg, 1g, 500mg, 5g, 25g.
1-isocyanato-2-phenylbenzene (CAS 17337-13-2) is a chemical compound with the molecular formula C13H9NO and a molecular weight of 195.22 g/mol. IUPAC name: 1-isocyanato-2-phenylbenzene. InChIKey: IHHUGFJSEJSCGE-UHFFFAOYSA-N.
| Molecular formula | C13H9NO |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 1-isocyanato-2-phenylbenzene |
| InChIKey | IHHUGFJSEJSCGE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2N=C=O |
Computed by PubChem (NCBI)