Products 17381-54-3
CAS 17381-54-3 appears in our catalog under these names: Benzo(b)thiophene-5-acetic Acid, 2-(Benzo(b)thiophen-5-yl)acetic acid, 95%, 2-(1-Benzothiophen-5-yl)acetic acid. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(1-benzothiophen-5-yl)acetic acid (CAS 17381-54-3) is a chemical compound with the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. IUPAC name: 2-(1-benzothiophen-5-yl)acetic acid. InChIKey: HOVPXJOSTYXDCM-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 2-(1-benzothiophen-5-yl)acetic acid |
| InChIKey | HOVPXJOSTYXDCM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CS2)C=C1CC(=O)O |
Computed by PubChem (NCBI)