CAS 174096-41-4 appears in our catalog under these names: 3–(4–Pyridyl)–D–Alanine·2HCl, H-D-4-Pal-OH·2HCl, 98%, H-D-4-Pal-OH.2HCl, 99.9%, 3-(4-Pyridyl)-d-alanine.2hcl, 98%, (R)-2-Amino-3-(pyridin-4-yl)propanoic acid hydrochloride, 98%, 98%. Offered by: GLPBio, AmBeed, MedChemExpress, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 1g, 100mg, 5 g, 10 g, 25g.
(2R)-2-amino-3-pyridin-4-ylpropanoic acid;dihydrochloride (CAS 174096-41-4) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: (2R)-2-amino-3-pyridin-4-ylpropanoic acid;dihydrochloride. InChIKey: NAMMTAFKUFJMSD-XCUBXKJBSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | (2R)-2-amino-3-pyridin-4-ylpropanoic acid;dihydrochloride |
| InChIKey | NAMMTAFKUFJMSD-XCUBXKJBSA-N |
| SMILES | C1=CN=CC=C1C[C@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)