CAS 174150-58-4 is the registry number for 2-Benzoyloxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1,3-oxazol-2-yl(phenyl)methanone (CAS 174150-58-4) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: 1,3-oxazol-2-yl(phenyl)methanone. InChIKey: LAYXHUOYWYRVDY-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 1,3-oxazol-2-yl(phenyl)methanone |
| InChIKey | LAYXHUOYWYRVDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NC=CO2 |
Computed by PubChem (NCBI)