CAS 17438-14-1 is the registry number for Nifedipine Impurity 23. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 17438-14-1) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: FKDYIXOYTANTSV-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | FKDYIXOYTANTSV-UHFFFAOYSA-N |
| SMILES | CC1=C(CC(=C(N1)C)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)