Products 174422-17-4
CAS 174422-17-4 is the registry number for 2-(4-Methoxyphenyl)-1H-benzo[d]imidazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylic acid (CAS 174422-17-4) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylic acid. InChIKey: VQGVZGRTDWXQJE-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylic acid |
| InChIKey | VQGVZGRTDWXQJE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC3=C(N2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)