CAS 174732-96-8 appears in our catalog under these names: N–Boc–3–hydroxy–DL–phenylalanine, Boc-DL-m-tyrosine. Offered by: GLPBio, Biosynth. Available pack sizes: 5mg, 0,5g, 5g.
3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 174732-96-8) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: 3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: FABANBOJFXYSHH-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | FABANBOJFXYSHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC(=CC=C1)O)C(=O)O |
Computed by PubChem (NCBI)