CAS 90819-32-2 appears in our catalog under these names: N-Boc-3-hydroxy-D-phenylalanine, 95%, N–Boc–3–hydroxy–D–phenylalanine, N-Boc-3-hydroxy-D-phenylalanine. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 100mg.
(2R)-3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 90819-32-2) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: (2R)-3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: FABANBOJFXYSHH-LLVKDONJSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (2R)-3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | FABANBOJFXYSHH-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=CC=C1)O)C(=O)O |
Computed by PubChem (NCBI)