CAS 90819-30-0 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)–3–(3–hydroxyphenyl)propanoic acid, Boc-L-Phe(3-OH)-OH, L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-3-hydroxy-, 98%, 98%, Boc-L-meta-tyrosine, 97%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25g.
(2S)-3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 90819-30-0) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: (2S)-3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: FABANBOJFXYSHH-NSHDSACASA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (2S)-3-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | FABANBOJFXYSHH-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC=C1)O)C(=O)O |
Computed by PubChem (NCBI)