CAS 178432-48-9 appears in our catalog under these names: Fmoc-l-phe(3-oh)-oh, 97%, (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–3–(3–hydroxyphenyl)propanoic acid, Fmoc-L-Phe(3-OH)-OH, N-Fmoc-3-hydroxy-L-phenylalanine, Fmoc-Phe(3-OH)-OH 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 2,5g, 100mg, 100g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-hydroxyphenyl)propanoic acid (CAS 178432-48-9) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-hydroxyphenyl)propanoic acid. InChIKey: QTAKQPPYEQCJTJ-QFIPXVFZSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-hydroxyphenyl)propanoic acid |
| InChIKey | QTAKQPPYEQCJTJ-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=CC=C4)O)C(=O)O |
Computed by PubChem (NCBI)