CAS 1217724-28-1 appears in our catalog under these names: N-Fmoc-3-hydroxy-d-phenylalanine, 97%, Fmoc-D-Phe(3-OH)-OH, Fmoc-D-m-Tyr-OH 98%, N-Fmoc-3-hydroxy-D-phenylalanine, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-hydroxyphenyl)propanoic acid (CAS 1217724-28-1) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-hydroxyphenyl)propanoic acid. InChIKey: QTAKQPPYEQCJTJ-JOCHJYFZSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-hydroxyphenyl)propanoic acid |
| InChIKey | QTAKQPPYEQCJTJ-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=CC=C4)O)C(=O)O |
Computed by PubChem (NCBI)